Pigment yellow 65 – Corimax Yellow RN
Parametreyên teknîkî yên rengê zer 65
| Index rengîn No. | Pigment zer 65 |
| Navê hilberê | Corimax Yellow RN |
| Kategoriya hilberê | Pigmentiya organîk |
| Hejmara CAS | 6528-34-3 |
| Hejmara EU | 229-419-9 |
| Malbata kîmyewî | Monazo |
| Wexta Molekul | 386.36 |
| Formula Molekular | C18H18N4O6 |
| Nirxa PH | 6.0-7.0 |
| Dendbûn | 1.6 |
| Germbûna rûn (ml / 100g)% | 35-45 |
| Fastermbûnek ronahî | 7 |
| Berxwedana Germê (dorpêçkirin) | 140 |
| Berxwedana Avê | 5 |
| Bihayê berxwedanê | 3 |
| Bihayê Acid | 5 |
| Bijî Alkali | 5 |
Reng | ![]() |
| Dabeşkirina Hue |
Taybetmendî: Dabeşek baş.
Bikaranînî:
Ji bo kevirên mîmarî, rûkulên pîşesaziyê têne pêşniyar kirin.
Agahdariya têkildar
Pigment Yellow 65 is a high-performance, bright yellow pigment widely used in coatings, inks, plastics, and paints. It offers excellent lightfastness, weather resistance, and chemical stability, making it suitable for both indoor and outdoor applications. Known for its vibrant, clean yellow hue, it provides strong color strength and opacity, ensuring high-quality results. Pigment Yellow 65 is particularly popular in automotive coatings, printing inks, and industrial applications where durability and consistency are crucial. With its non-toxic and environmentally friendly properties, it is a reliable choice for manufacturers seeking long-lasting and vivid yellow colors.
Struktura Molekular:
Formula Molekular: C18H18N4O6
Wexta Molekul: 386.36
Jimara Registry CAS: 6528-34-3
Rêbazên uringêkirinê: 4-Methoxy-2-nitrobenzenamine diazotization, and N- (2-methoxyphenyl) -3-oxobutanamide bashk.
Taybetmendî û Serlêdan: ronahiya sor a zer. Pîvaza sor. Zûtirîna tîrêja rojê çêtir e. Baweriya Cellosole, kerosene, nekare ku xilîn, acid-proof alkaline çêtir hilîne an teng bike. Di navbênra rûn de, nemaze di bikaranîna kevirên laş de, karanîna rûkenî, rûk, çandî û amûrên perwerdehiyê jî tê bikar anîn.
Structural Identifiers
IUPAC Name: 2-[(4-Methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide
SMILES: COC1=CC(=C(C=C1)N=NC(C(C)=O)C(=O)NC1=C(OC)C=CC=C1)[N+]([O-])=O
InChI String: InChI=1/C18H18N4O6/c1-11(23)17(18(24)19-14-6-4-5-7-16(14)28-3)21-20-13-9-8-12(27-2)10-15(13)22(25)26/h4-10,17H,1-3H3,(H,19,24)
InChIKey: UFORAEIAYCSGCR-UHFFFAOYSA-N
Sînonîm
| 6528-34-3 |
| Permanent Yellow Rn |
| YELLOW65 |
| 2-[(4-methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide |
| Butanamide,2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-((4-methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| 2-[2-(4-METHOXY-2-NITROPHENYL)DIAZEN-1-YL]-N-(2-METHOXYPHENYL)-3-OXOBUTANAMIDE |
| EINECS 229-419-9 |
| EC 229-419-9 |
| SCHEMBL6928762 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-o-acetoacetanisidide |
| DTXSID0052336 |
| SCHEMBL12760851 |
| UFORAEIAYCSGCR-UHFFFAOYSA-N |
| HY-D1204 |
| MFCD00071941 |
| AKOS037643608 |
| Butanamide, 2-(2-(4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxo- |
| AS-17500 |
| CS-0143082 |
| NS00003477 |
| EN300-207584 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxobutyramide |
| (E)-2-((4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxobutanamide |
Taybetmendiyên Hesabkirî
| Navê Taybetmendiyê | Nirxa Taybetmendiyê |
| Wexta Molekul | 386.4 g/mol |
| XLogP3-AA | 3.3 |
| Hidrojen Bond Donor Count | 1 |
| Hidrojen Bond Acceptor Count | 8 |
| Count Bond Rotatable | 7 |
| Mass Rast | 386.12263431 Da |
| Komkujiya Monoisotopic | 386.12263431 Da |
| Topological Polar Surface Area | 135 Ų |
| Heavy Atom Count | 28 |
| Barkirina Fermî | 0 |
| Tevlihevî | 593 |
| Hejmara Atomê Îzotopê | 0 |
| Hejmara Stereocenter Atom diyar kir | 0 |
| Hejmara Streocenter a Atomê ne diyarkirî | 1 |
| Hejmara Stereocenter Bond diyarkirî | 0 |
| Hejmara Stereocenter a Bondê ya nenaskirî | 0 |
| Covalently-Bonded Unit Count | 1 |
| Pêkhatî Kanonîkî ye | Erê |











